C7H9F5O2 — CID 20651944
4,4,5,5,6-pentafluorohept-6-ene-1,2-diol (PubChem CID 20651944) has the molecular formula C7H9F5O2 and a molecular weight of 220.14 g/mol. Its IUPAC name is 4,4,5,5,6-pentafluorohept-6-ene-1,2-diol.
| Compound Name | 4,4,5,5,6-pentafluorohept-6-ene-1,2-diol |
|---|---|
| PubChem CID | 20651944 |
| Molecular Formula | C7H9F5O2 |
| Molecular Weight | 220.14 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 4,4,5,5,6-pentafluorohept-6-ene-1,2-diol |
| SMILES | C=C(F)C(F)(F)C(F)(F)CC(O)CO |
| InChI | InChI=1S/C7H9F5O2/c1-4(8)7(11,12)6(9,10)2-5(14)3-13/h5,13-14H,1-3H2 |
| InChIKey | PXGYVYCURSDDQA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.14 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|