C23H36AcO7 — CID 20652038
actinium;2,5,10,15,17-pentahydroxy-4,13,18,19,19-pentamethyl-8-oxatetracyclo[13.3.1.04,11.07,10]nonadec-1(18)-en-3-one (PubChem CID 20652038) has the molecular formula C23H36AcO7 and a molecular weight of 651.53 g/mol. Its IUPAC name is actinium;2,5,10,15,17-pentahydroxy-4,13,18,19,19-pentamethyl-8-oxatetracyclo[13.3.1.04,11.07,10]nonadec-1(18)-en-3-one.
| Compound Name | actinium;2,5,10,15,17-pentahydroxy-4,13,18,19,19-pentamethyl-8-oxatetracyclo[13.3.1.04,11.07,10]nonadec-1(18)-en-3-one |
|---|---|
| PubChem CID | 20652038 |
| Molecular Formula | C23H36AcO7 |
| Molecular Weight | 651.53 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | actinium;2,5,10,15,17-pentahydroxy-4,13,18,19,19-pentamethyl-8-oxatetracyclo[13.3.1.04,11.07,10]nonadec-1(18)-en-3-one |
| SMILES | CC1=C2C(O)C(=O)C3(C)C(O)CC4OCC4(O)C3CC(C)CC(O)(CC1O)C2(C)C.[Ac] |
| InChI | InChI=1S/C23H36O7.Ac/c1-11-6-14-21(5,15(25)7-16-23(14,29)10-30-16)19(27)18(26)17-12(2)13(24)9-22(28,8-11)20(17,3)4;/h11,13-16,18,24-26,28-29H,6-10H2,1-5H3; |
| InChIKey | HUGZIZOWCSKEPD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.53 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|