C22H20N6 — CID 20652058
2-[4-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4,6-dimethyl-1,3,5-triazine (PubChem CID 20652058) has the molecular formula C22H20N6 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[4-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4,6-dimethyl-1,3,5-triazine.
| Compound Name | 2-[4-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4,6-dimethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 20652058 |
| Molecular Formula | C22H20N6 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-[4-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-4,6-dimethyl-1,3,5-triazine |
| SMILES | Cc1nc(C)nc(-c2ccc(-c3ccc(-c4nc(C)nc(C)n4)cc3)cc2)n1 |
| InChI | InChI=1S/C22H20N6/c1-13-23-14(2)26-21(25-13)19-9-5-17(6-10-19)18-7-11-20(12-8-18)22-27-15(3)24-16(4)28-22/h5-12H,1-4H3 |
| InChIKey | ASXJWBGTQXNUSO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |