C45H32N6 — CID 20652069
2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 20652069) has the molecular formula C45H32N6 and a molecular weight of 656.79 g/mol. Its IUPAC name is 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 20652069 |
| Molecular Formula | C45H32N6 |
| Molecular Weight | 656.79 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-dimethylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C45H32N6/c1-45(2)37-27-33(43-48-39(29-15-7-3-8-16-29)46-40(49-43)30-17-9-4-10-18-30)23-25-35(37)36-26-24-34(28-38(36)45)44-50-41(31-19-11-5-12-20-31)47-42(51-44)32-21-13-6-14-22-32/h3-28H,1-2H3 |
| InChIKey | IWDBDCMLVWTPCT-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.79 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |