C55H36N6 — CID 20652070
2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 20652070) has the molecular formula C55H36N6 and a molecular weight of 780.94 g/mol. Its IUPAC name is 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 20652070 |
| Molecular Formula | C55H36N6 |
| Molecular Weight | 780.94 g/mol |
| Exact Mass | 780.30 |
| IUPAC Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3cc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)ccc3-4)n2)cc1 |
| InChI | InChI=1S/C55H36N6/c1-7-19-37(20-8-1)49-56-50(38-21-9-2-10-22-38)59-53(58-49)41-31-33-45-46-34-32-42(54-60-51(39-23-11-3-12-24-39)57-52(61-54)40-25-13-4-14-26-40)36-48(46)55(47(45)35-41,43-27-15-5-16-28-43)44-29-17-6-18-30-44/h1-36H |
| InChIKey | XUDQJMBTYVLZCG-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.94 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |