C21H25NO5 — CID 20652099
(4-methoxycarbonyl-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl) 3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 20652099) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is (4-methoxycarbonyl-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl) 3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | (4-methoxycarbonyl-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl) 3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 20652099 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (4-methoxycarbonyl-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl) 3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | COC(=O)C1=COC(OC(=O)N2CCc3ccccc3C2)C2C(C)CCC12 |
| InChI | InChI=1S/C21H25NO5/c1-13-7-8-16-17(19(23)25-2)12-26-20(18(13)16)27-21(24)22-10-9-14-5-3-4-6-15(14)11-22/h3-6,12-13,16,18,20H,7-11H2,1-2H3 |
| InChIKey | PGEZUVSDLHWGKU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |