C17H25N3O5 — CID 20652152
[2-methyl-7-(4-methylpiperazine-1-carbonyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate (PubChem CID 20652152) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is [2-methyl-7-(4-methylpiperazine-1-carbonyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate.
| Compound Name | [2-methyl-7-(4-methylpiperazine-1-carbonyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 20652152 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [2-methyl-7-(4-methylpiperazine-1-carbonyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC1OC=C(C(=O)N2CCN(C)CC2)C2CC3OC3(C)C12 |
| InChI | InChI=1S/C17H25N3O5/c1-17-12(25-17)8-10-11(14(21)20-6-4-19(3)5-7-20)9-23-15(13(10)17)24-16(22)18-2/h9-10,12-13,15H,4-8H2,1-3H3,(H,18,22) |
| InChIKey | DRYBPAUJZSHRDC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|