C15H22N2O5 — CID 20652160
[7-(dimethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N,N-dimethylcarbamate (PubChem CID 20652160) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is [7-(dimethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N,N-dimethylcarbamate.
| Compound Name | [7-(dimethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 20652160 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [7-(dimethylcarbamoyl)-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OC1OC=C(C(=O)N(C)C)C2CC3OC3(C)C12 |
| InChI | InChI=1S/C15H22N2O5/c1-15-10(22-15)6-8-9(12(18)16(2)3)7-20-13(11(8)15)21-14(19)17(4)5/h7-8,10-11,13H,6H2,1-5H3 |
| InChIKey | VURHHQXONSDHSQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 71.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|