C12H16N2O5 — CID 20652163
(7-carbamoyl-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl) N-methylcarbamate (PubChem CID 20652163) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is (7-carbamoyl-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl) N-methylcarbamate.
| Compound Name | (7-carbamoyl-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl) N-methylcarbamate |
|---|---|
| PubChem CID | 20652163 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (7-carbamoyl-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl) N-methylcarbamate |
| SMILES | CNC(=O)OC1OC=C(C(N)=O)C2CC3OC3(C)C12 |
| InChI | InChI=1S/C12H16N2O5/c1-12-7(19-12)3-5-6(9(13)15)4-17-10(8(5)12)18-11(16)14-2/h4-5,7-8,10H,3H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | HVBDBLMLSXMWOF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|