C20H32O5 — CID 20652245
methyl 1-(1-ethoxyethoxy)-7-hexyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 20652245) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is methyl 1-(1-ethoxyethoxy)-7-hexyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl 1-(1-ethoxyethoxy)-7-hexyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 20652245 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | methyl 1-(1-ethoxyethoxy)-7-hexyl-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | CCCCCCC1=CCC2C(C(=O)OC)=COC(OC(C)OCC)C12 |
| InChI | InChI=1S/C20H32O5/c1-5-7-8-9-10-15-11-12-16-17(19(21)22-4)13-24-20(18(15)16)25-14(3)23-6-2/h11,13-14,16,18,20H,5-10,12H2,1-4H3 |
| InChIKey | DFBJEYKRSTWGIZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|