About 1,2,3-trimethyl-1H-imidazole-1,3-diium
1,2,3-trimethyl-1H-imidazole-1,3-diium (PubChem CID 20652611) has the molecular formula C6H12N2+2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 1,2,3-trimethyl-1H-imidazole-1,3-diium.
Molecular Properties
| Compound Name | 1,2,3-trimethyl-1H-imidazole-1,3-diium |
| PubChem CID | 20652611 |
| Molecular Formula | C6H12N2+2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1,2,3-trimethyl-1H-imidazole-1,3-diium |
| SMILES | CC1=[N+](C)C=C[NH+]1C |
| InChI | InChI=1S/C6H11N2/c1-6-7(2)4-5-8(6)3/h4-5H,1-3H3/q+1/p+1 |
| InChIKey | KCUGPPHNMASOTE-UHFFFAOYSA-O |
| XLogP | -0.95 |
| TPSA | 7.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trimethyl-1H-imidazole-1,3-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethyl-1H-imidazole-1,3-diium?
The IUPAC name of 1,2,3-trimethyl-1H-imidazole-1,3-diium (CID 20652611) is 1,2,3-trimethyl-1H-imidazole-1,3-diium.
What is the SMILES notation for 1,2,3-trimethyl-1H-imidazole-1,3-diium?
The canonical SMILES for 1,2,3-trimethyl-1H-imidazole-1,3-diium is CC1=[N+](C)C=C[NH+]1C.
What is the InChIKey of 1,2,3-trimethyl-1H-imidazole-1,3-diium?
The InChIKey is KCUGPPHNMASOTE-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H11N2/c1-6-7(2)4-5-8(6)3/h4-5H,1-3H3/q+1/p+1.
What are the key properties of 1,2,3-trimethyl-1H-imidazole-1,3-diium?
1,2,3-trimethyl-1H-imidazole-1,3-diium has a molecular weight of 112.18 g/mol, XLogP of -0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethyl-1H-imidazole-1,3-diium is sourced from PubChem (CID 20652611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).