C30H29N2NaO6S2 — CID 20652641
sodium 3-[[N-ethyl-4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-(2-sulfophenyl)methyl]anilino]methyl]benzenesulfonate (PubChem CID 20652641) has the molecular formula C30H29N2NaO6S2 and a molecular weight of 600.69 g/mol. Its IUPAC name is sodium 3-[[N-ethyl-4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-(2-sulfophenyl)methyl]anilino]methyl]benzenesulfonate.
| Compound Name | sodium 3-[[N-ethyl-4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-(2-sulfophenyl)methyl]anilino]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 20652641 |
| Molecular Formula | C30H29N2NaO6S2 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | sodium 3-[[N-ethyl-4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-(2-sulfophenyl)methyl]anilino]methyl]benzenesulfonate |
| SMILES | CCN=C1C=CC(=C(c2ccc(N(CC)Cc3cccc(S(=O)(=O)[O-])c3)cc2)c2ccccc2S(=O)(=O)O)C=C1.[Na+] |
| InChI | InChI=1S/C30H30N2O6S2.Na/c1-3-31-25-16-12-23(13-17-25)30(28-10-5-6-11-29(28)40(36,37)38)24-14-18-26(19-15-24)32(4-2)21-22-8-7-9-27(20-22)39(33,34)35;/h5-20H,3-4,21H2,1-2H3,(H,33,34,35)(H,36,37,38);/q;+1/p-1/b30-23-,31-25+; |
| InChIKey | AOQCBTQZGANETP-NQDNFLAYSA-M |
| XLogP | 2.26 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|