C29H38N7O6S2+ — CID 20652876
N-[2-[2-(ethoxyamino)ethylsulfanyl]ethyl]-1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]pyridin-1-ium-3-carboxamide (PubChem CID 20652876) has the molecular formula C29H38N7O6S2+ and a molecular weight of 644.80 g/mol. Its IUPAC name is N-[2-[2-(ethoxyamino)ethylsulfanyl]ethyl]-1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]pyridin-1-ium-3-carboxamide.
| Compound Name | N-[2-[2-(ethoxyamino)ethylsulfanyl]ethyl]-1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 20652876 |
| Molecular Formula | C29H38N7O6S2+ |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | N-[2-[2-(ethoxyamino)ethylsulfanyl]ethyl]-1-[2-[3-[[4-(2-formylhydrazinyl)phenyl]sulfamoyl]-2,6-dimethylanilino]-2-oxoethyl]pyridin-1-ium-3-carboxamide |
| SMILES | CCONCCSCCNC(=O)c1ccc[n+](CC(=O)Nc2c(C)ccc(S(=O)(=O)Nc3ccc(NNC=O)cc3)c2C)c1 |
| InChI | InChI=1S/C29H37N7O6S2/c1-4-42-32-14-17-43-16-13-30-29(39)23-6-5-15-36(18-23)19-27(38)33-28-21(2)7-12-26(22(28)3)44(40,41)35-25-10-8-24(9-11-25)34-31-20-37/h5-12,15,18,20,32,34-35H,4,13-14,16-17,19H2,1-3H3,(H2-,30,31,33,37,38,39)/p+1 |
| InChIKey | GFMBOHAZDWXBAP-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 170.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|