About 4-(difluoromethoxy)-2,6-dimethylpyrimidine
4-(difluoromethoxy)-2,6-dimethylpyrimidine (PubChem CID 20652992) has the molecular formula C7H8F2N2O
and a molecular weight of 174.15 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 4-(difluoromethoxy)-2,6-dimethylpyrimidine |
| PubChem CID | 20652992 |
| Molecular Formula | C7H8F2N2O |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 4-(difluoromethoxy)-2,6-dimethylpyrimidine |
| SMILES | Cc1cc(OC(F)F)nc(C)n1 |
| InChI | InChI=1S/C7H8F2N2O/c1-4-3-6(12-7(8)9)11-5(2)10-4/h3,7H,1-2H3 |
| InChIKey | QMBPIVVDZYYHBS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(difluoromethoxy)-2,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethoxy)-2,6-dimethylpyrimidine?
The IUPAC name of 4-(difluoromethoxy)-2,6-dimethylpyrimidine (CID 20652992) is 4-(difluoromethoxy)-2,6-dimethylpyrimidine.
What is the SMILES notation for 4-(difluoromethoxy)-2,6-dimethylpyrimidine?
The canonical SMILES for 4-(difluoromethoxy)-2,6-dimethylpyrimidine is Cc1cc(OC(F)F)nc(C)n1.
What is the InChIKey of 4-(difluoromethoxy)-2,6-dimethylpyrimidine?
The InChIKey is QMBPIVVDZYYHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O/c1-4-3-6(12-7(8)9)11-5(2)10-4/h3,7H,1-2H3.
What are the key properties of 4-(difluoromethoxy)-2,6-dimethylpyrimidine?
4-(difluoromethoxy)-2,6-dimethylpyrimidine has a molecular weight of 174.15 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethoxy)-2,6-dimethylpyrimidine is sourced from PubChem (CID 20652992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).