C20H29NO — CID 20653325
1,2,4,5,6,7-hexamethyl-3-(2-propan-2-yloxyprop-2-enyl)indole (PubChem CID 20653325) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is 1,2,4,5,6,7-hexamethyl-3-(2-propan-2-yloxyprop-2-enyl)indole.
| Compound Name | 1,2,4,5,6,7-hexamethyl-3-(2-propan-2-yloxyprop-2-enyl)indole |
|---|---|
| PubChem CID | 20653325 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 1,2,4,5,6,7-hexamethyl-3-(2-propan-2-yloxyprop-2-enyl)indole |
| SMILES | C=C(Cc1c(C)n(C)c2c(C)c(C)c(C)c(C)c12)OC(C)C |
| InChI | InChI=1S/C20H29NO/c1-11(2)22-12(3)10-18-17(8)21(9)20-16(7)14(5)13(4)15(6)19(18)20/h11H,3,10H2,1-2,4-9H3 |
| InChIKey | FXFGSSJTZITLID-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|