C27H31N3O2 — CID 20653361
2-[[4-[2-(4-cyclohexyloxyphenoxy)ethyl-ethylamino]-2-methylphenyl]methylidene]propanedinitrile (PubChem CID 20653361) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-[[4-[2-(4-cyclohexyloxyphenoxy)ethyl-ethylamino]-2-methylphenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[2-(4-cyclohexyloxyphenoxy)ethyl-ethylamino]-2-methylphenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 20653361 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[[4-[2-(4-cyclohexyloxyphenoxy)ethyl-ethylamino]-2-methylphenyl]methylidene]propanedinitrile |
| SMILES | CCN(CCOc1ccc(OC2CCCCC2)cc1)c1ccc(C=C(C#N)C#N)c(C)c1 |
| InChI | InChI=1S/C27H31N3O2/c1-3-30(24-10-9-23(21(2)17-24)18-22(19-28)20-29)15-16-31-25-11-13-27(14-12-25)32-26-7-5-4-6-8-26/h9-14,17-18,26H,3-8,15-16H2,1-2H3 |
| InChIKey | CZUYCELEUOYRCE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|