C19H23ClF4OS2 — CID 20653867
2-[4-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]cyclohexyl]-5-(methoxymethyl)-1,3-dithiane (PubChem CID 20653867) has the molecular formula C19H23ClF4OS2 and a molecular weight of 442.97 g/mol. Its IUPAC name is 2-[4-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]cyclohexyl]-5-(methoxymethyl)-1,3-dithiane.
| Compound Name | 2-[4-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]cyclohexyl]-5-(methoxymethyl)-1,3-dithiane |
|---|---|
| PubChem CID | 20653867 |
| Molecular Formula | C19H23ClF4OS2 |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-[4-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]cyclohexyl]-5-(methoxymethyl)-1,3-dithiane |
| SMILES | COCC1CSC(C2CCC(c3cc(F)c(C(F)(F)Cl)c(F)c3)CC2)SC1 |
| InChI | InChI=1S/C19H23ClF4OS2/c1-25-8-11-9-26-18(27-10-11)13-4-2-12(3-5-13)14-6-15(21)17(16(22)7-14)19(20,23)24/h6-7,11-13,18H,2-5,8-10H2,1H3 |
| InChIKey | QJTCEWHLNXMMSD-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|