C20H17F7O3 — CID 20653935
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-propyl-1,3-dioxane (PubChem CID 20653935) has the molecular formula C20H17F7O3 and a molecular weight of 438.34 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 20653935 |
| Molecular Formula | C20H17F7O3 |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C20H17F7O3/c1-2-3-10-8-28-19(29-9-10)11-4-13(21)17(14(22)5-11)20(26,27)30-12-6-15(23)18(25)16(24)7-12/h4-7,10,19H,2-3,8-9H2,1H3 |
| InChIKey | UGOWFGHCPJGZLF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|