C28H25F7O — CID 20654144
2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene (PubChem CID 20654144) has the molecular formula C28H25F7O and a molecular weight of 510.49 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene.
| Compound Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 20654144 |
| Molecular Formula | C28H25F7O |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[4-(4-propylcyclohexyl)phenyl]benzene |
| SMILES | CCCC1CCC(c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C28H25F7O/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-22(29)26(23(30)13-20)28(34,35)36-21-14-24(31)27(33)25(32)15-21/h8-17H,2-7H2,1H3 |
| InChIKey | OHJMPNHUCWDQKQ-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|