C31H29F6NO — CID 20654236
4-[[4-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-2,6-difluorophenyl]-difluoromethoxy]benzonitrile (PubChem CID 20654236) has the molecular formula C31H29F6NO and a molecular weight of 545.57 g/mol. Its IUPAC name is 4-[[4-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-2,6-difluorophenyl]-difluoromethoxy]benzonitrile.
| Compound Name | 4-[[4-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-2,6-difluorophenyl]-difluoromethoxy]benzonitrile |
|---|---|
| PubChem CID | 20654236 |
| Molecular Formula | C31H29F6NO |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 4-[[4-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-2,6-difluorophenyl]-difluoromethoxy]benzonitrile |
| SMILES | CCCCCC1CCC(c2cc(F)c(-c3cc(F)c(C(F)(F)Oc4ccc(C#N)cc4)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C31H29F6NO/c1-2-3-4-5-19-6-10-21(11-7-19)22-14-25(32)29(26(33)15-22)23-16-27(34)30(28(35)17-23)31(36,37)39-24-12-8-20(18-38)9-13-24/h8-9,12-17,19,21H,2-7,10-11H2,1H3 |
| InChIKey | ONROVQJHLMTBMN-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|