C14H21FN4OS — CID 20654288
[2-(5-fluoro-4-methylsulfanylpyrimidin-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol (PubChem CID 20654288) has the molecular formula C14H21FN4OS and a molecular weight of 312.41 g/mol. Its IUPAC name is [2-(5-fluoro-4-methylsulfanylpyrimidin-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol.
| Compound Name | [2-(5-fluoro-4-methylsulfanylpyrimidin-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol |
|---|---|
| PubChem CID | 20654288 |
| Molecular Formula | C14H21FN4OS |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [2-(5-fluoro-4-methylsulfanylpyrimidin-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methanol |
| SMILES | CSc1nc(N2CCN3CC(CO)CCC3C2)ncc1F |
| InChI | InChI=1S/C14H21FN4OS/c1-21-13-12(15)6-16-14(17-13)19-5-4-18-7-10(9-20)2-3-11(18)8-19/h6,10-11,20H,2-5,7-9H2,1H3 |
| InChIKey | FXRVUUQPBNYOJV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |