About 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid
2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 20654296) has the molecular formula C19H31NO12
and a molecular weight of 465.45 g/mol. Its IUPAC name is 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid |
| PubChem CID | 20654296 |
| Molecular Formula | C19H31NO12 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CC(=O)OCC(COC(=O)CCC(=O)NCCOCCOCCOCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C19H31NO12/c1-14(21)30-11-16(32-15(2)22)12-31-19(26)4-3-17(23)20-5-6-27-7-8-28-9-10-29-13-18(24)25/h16H,3-13H2,1-2H3,(H,20,23)(H,24,25) |
| InChIKey | PKIUUXQUDQAZQD-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid?
The IUPAC name of 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid (CID 20654296) is 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid.
What is the SMILES notation for 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid?
The canonical SMILES for 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid is CC(=O)OCC(COC(=O)CCC(=O)NCCOCCOCCOCC(=O)O)OC(C)=O.
What is the InChIKey of 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid?
The InChIKey is PKIUUXQUDQAZQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NO12/c1-14(21)30-11-16(32-15(2)22)12-31-19(26)4-3-17(23)20-5-6-27-7-8-28-9-10-29-13-18(24)25/h16H,3-13H2,1-2H3,(H,20,23)(H,24,25).
What are the key properties of 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid?
2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid has a molecular weight of 465.45 g/mol, XLogP of -0.94, 19 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[2-[[4-(2,3-diacetyloxypropoxy)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]acetic acid is sourced from PubChem (CID 20654296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).