About 2,3-dimethoxypent-4-enal
2,3-dimethoxypent-4-enal (PubChem CID 20654322) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2,3-dimethoxypent-4-enal.
Molecular Properties
| Compound Name | 2,3-dimethoxypent-4-enal |
| PubChem CID | 20654322 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 2,3-dimethoxypent-4-enal |
| SMILES | C=CC(OC)C(C=O)OC |
| InChI | InChI=1S/C7H12O3/c1-4-6(9-2)7(5-8)10-3/h4-7H,1H2,2-3H3 |
| InChIKey | VVBBKAZADRBKKL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethoxypent-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxypent-4-enal?
The IUPAC name of 2,3-dimethoxypent-4-enal (CID 20654322) is 2,3-dimethoxypent-4-enal.
What is the SMILES notation for 2,3-dimethoxypent-4-enal?
The canonical SMILES for 2,3-dimethoxypent-4-enal is C=CC(OC)C(C=O)OC.
What is the InChIKey of 2,3-dimethoxypent-4-enal?
The InChIKey is VVBBKAZADRBKKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-4-6(9-2)7(5-8)10-3/h4-7H,1H2,2-3H3.
What are the key properties of 2,3-dimethoxypent-4-enal?
2,3-dimethoxypent-4-enal has a molecular weight of 144.17 g/mol, XLogP of 0.40, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxypent-4-enal is sourced from PubChem (CID 20654322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).