About 4-methyl-N,N-bis(4-nitrophenyl)aniline
4-methyl-N,N-bis(4-nitrophenyl)aniline (PubChem CID 20654618) has the molecular formula C19H15N3O4
and a molecular weight of 349.35 g/mol. Its IUPAC name is 4-methyl-N,N-bis(4-nitrophenyl)aniline.
Molecular Properties
| Compound Name | 4-methyl-N,N-bis(4-nitrophenyl)aniline |
| PubChem CID | 20654618 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-methyl-N,N-bis(4-nitrophenyl)aniline |
| SMILES | Cc1ccc(N(c2ccc([N+](=O)[O-])cc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H15N3O4/c1-14-2-4-15(5-3-14)20(16-6-10-18(11-7-16)21(23)24)17-8-12-19(13-9-17)22(25)26/h2-13H,1H3 |
| InChIKey | RQYDQSYNPQNUKG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N,N-bis(4-nitrophenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N,N-bis(4-nitrophenyl)aniline?
The IUPAC name of 4-methyl-N,N-bis(4-nitrophenyl)aniline (CID 20654618) is 4-methyl-N,N-bis(4-nitrophenyl)aniline.
What is the SMILES notation for 4-methyl-N,N-bis(4-nitrophenyl)aniline?
The canonical SMILES for 4-methyl-N,N-bis(4-nitrophenyl)aniline is Cc1ccc(N(c2ccc([N+](=O)[O-])cc2)c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of 4-methyl-N,N-bis(4-nitrophenyl)aniline?
The InChIKey is RQYDQSYNPQNUKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O4/c1-14-2-4-15(5-3-14)20(16-6-10-18(11-7-16)21(23)24)17-8-12-19(13-9-17)22(25)26/h2-13H,1H3.
What are the key properties of 4-methyl-N,N-bis(4-nitrophenyl)aniline?
4-methyl-N,N-bis(4-nitrophenyl)aniline has a molecular weight of 349.35 g/mol, XLogP of 5.28, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N,N-bis(4-nitrophenyl)aniline is sourced from PubChem (CID 20654618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).