About 4-methylsulfanyl-N,N-diphenylaniline
4-methylsulfanyl-N,N-diphenylaniline (PubChem CID 20654621) has the molecular formula C19H17NS
and a molecular weight of 291.42 g/mol. Its IUPAC name is 4-methylsulfanyl-N,N-diphenylaniline.
Molecular Properties
| Compound Name | 4-methylsulfanyl-N,N-diphenylaniline |
| PubChem CID | 20654621 |
| Molecular Formula | C19H17NS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-methylsulfanyl-N,N-diphenylaniline |
| SMILES | CSc1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17NS/c1-21-19-14-12-18(13-15-19)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15H,1H3 |
| InChIKey | ASCFLNCTVHFRMM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylsulfanyl-N,N-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-N,N-diphenylaniline?
The IUPAC name of 4-methylsulfanyl-N,N-diphenylaniline (CID 20654621) is 4-methylsulfanyl-N,N-diphenylaniline.
What is the SMILES notation for 4-methylsulfanyl-N,N-diphenylaniline?
The canonical SMILES for 4-methylsulfanyl-N,N-diphenylaniline is CSc1ccc(N(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-methylsulfanyl-N,N-diphenylaniline?
The InChIKey is ASCFLNCTVHFRMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NS/c1-21-19-14-12-18(13-15-19)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-15H,1H3.
What are the key properties of 4-methylsulfanyl-N,N-diphenylaniline?
4-methylsulfanyl-N,N-diphenylaniline has a molecular weight of 291.42 g/mol, XLogP of 5.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-N,N-diphenylaniline is sourced from PubChem (CID 20654621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).