C19H16B- — CID 20654780
8-methyl-8-phenyl-8-boranuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 20654780) has the molecular formula C19H16B- and a molecular weight of 255.15 g/mol. Its IUPAC name is 8-methyl-8-phenyl-8-boranuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 8-methyl-8-phenyl-8-boranuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 20654780 |
| Molecular Formula | C19H16B- |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 8-methyl-8-phenyl-8-boranuidatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | C[B-]1(c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H16B/c1-20(15-9-3-2-4-10-15)18-13-7-5-11-16(18)17-12-6-8-14-19(17)20/h2-14H,1H3/q-1 |
| InChIKey | LHBUYTUUQKEHIQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|