About [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate
[3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate (PubChem CID 20654888) has the molecular formula C11H11I2NO7S2
and a molecular weight of 587.15 g/mol. Its IUPAC name is [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate.
Molecular Properties
| Compound Name | [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate |
| PubChem CID | 20654888 |
| Molecular Formula | C11H11I2NO7S2 |
| Molecular Weight | 587.15 g/mol |
| Exact Mass | 586.81 |
| IUPAC Name | [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate |
| SMILES | O=C(/C=N/c1cc(OS(=O)(=O)CCI)ccc1SOOO)CI |
| InChI | InChI=1S/C11H11I2NO7S2/c12-3-4-23(17,18)19-9-1-2-11(22-21-20-16)10(5-9)14-7-8(15)6-13/h1-2,5,7,16H,3-4,6H2/b14-7+ |
| InChIKey | LMMQFXMLBBMIKG-VGOFMYFVSA-N |
| XLogP | 2.96 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 587.15 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate?
The IUPAC name of [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate (CID 20654888) is [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate.
What is the SMILES notation for [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate?
The canonical SMILES for [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate is O=C(/C=N/c1cc(OS(=O)(=O)CCI)ccc1SOOO)CI.
What is the InChIKey of [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate?
The InChIKey is LMMQFXMLBBMIKG-VGOFMYFVSA-N. The full InChI is InChI=1S/C11H11I2NO7S2/c12-3-4-23(17,18)19-9-1-2-11(22-21-20-16)10(5-9)14-7-8(15)6-13/h1-2,5,7,16H,3-4,6H2/b14-7+.
What are the key properties of [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate?
[3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate has a molecular weight of 587.15 g/mol, XLogP of 2.96, 10 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3-iodo-2-oxopropylidene)amino]-4-(trioxidanylsulfanyl)phenyl] 2-iodoethanesulfonate is sourced from PubChem (CID 20654888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).