About 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole
4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole (PubChem CID 20655084) has the molecular formula C12H14ClN5O6S
and a molecular weight of 391.79 g/mol. Its IUPAC name is 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole.
Molecular Properties
| Compound Name | 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole |
| PubChem CID | 20655084 |
| Molecular Formula | C12H14ClN5O6S |
| Molecular Weight | 391.79 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole |
| SMILES | Cn1nc(-n2ncc([N+](=O)[O-])c2C2OCCCO2)c(Cl)c1S(C)(=O)=O |
| InChI | InChI=1S/C12H14ClN5O6S/c1-16-11(25(2,21)22)8(13)10(15-16)17-9(7(6-14-17)18(19)20)12-23-4-3-5-24-12/h6,12H,3-5H2,1-2H3 |
| InChIKey | VPCGKXWSWAQWGD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 131.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.79 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole?
The IUPAC name of 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole (CID 20655084) is 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole.
What is the SMILES notation for 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole?
The canonical SMILES for 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole is Cn1nc(-n2ncc([N+](=O)[O-])c2C2OCCCO2)c(Cl)c1S(C)(=O)=O.
What is the InChIKey of 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole?
The InChIKey is VPCGKXWSWAQWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN5O6S/c1-16-11(25(2,21)22)8(13)10(15-16)17-9(7(6-14-17)18(19)20)12-23-4-3-5-24-12/h6,12H,3-5H2,1-2H3.
What are the key properties of 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole?
4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole has a molecular weight of 391.79 g/mol, XLogP of 1.01, 4 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-[5-(1,3-dioxan-2-yl)-4-nitropyrazol-1-yl]-1-methyl-5-methylsulfonylpyrazole is sourced from PubChem (CID 20655084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).