About benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate
benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate (PubChem CID 20655260) has the molecular formula C31H31N7O2S
and a molecular weight of 565.70 g/mol. Its IUPAC name is benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate.
Molecular Properties
| Compound Name | benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate |
| PubChem CID | 20655260 |
| Molecular Formula | C31H31N7O2S |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate |
| SMILES | O=C(On1nnc2ccccc21)c1ccc(-c2nnc(-c3ccc(N4CCN(C5CCCCC5)CC4)cc3)s2)cc1 |
| InChI | InChI=1S/C31H31N7O2S/c39-31(40-38-28-9-5-4-8-27(28)32-35-38)24-12-10-22(11-13-24)29-33-34-30(41-29)23-14-16-26(17-15-23)37-20-18-36(19-21-37)25-6-2-1-3-7-25/h4-5,8-17,25H,1-3,6-7,18-21H2 |
| InChIKey | HCLUEMJGAAPSLM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|
Analyze benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate?
The IUPAC name of benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate (CID 20655260) is benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate.
What is the SMILES notation for benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate?
The canonical SMILES for benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate is O=C(On1nnc2ccccc21)c1ccc(-c2nnc(-c3ccc(N4CCN(C5CCCCC5)CC4)cc3)s2)cc1.
What is the InChIKey of benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate?
The InChIKey is HCLUEMJGAAPSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H31N7O2S/c39-31(40-38-28-9-5-4-8-27(28)32-35-38)24-12-10-22(11-13-24)29-33-34-30(41-29)23-14-16-26(17-15-23)37-20-18-36(19-21-37)25-6-2-1-3-7-25/h4-5,8-17,25H,1-3,6-7,18-21H2.
What are the key properties of benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate?
benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate has a molecular weight of 565.70 g/mol, XLogP of 5.34, 6 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-1-yl 4-[5-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-1,3,4-thiadiazol-2-yl]benzoate is sourced from PubChem (CID 20655260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).