About 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine
7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine (PubChem CID 20655702) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine.
Molecular Properties
| Compound Name | 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine |
| PubChem CID | 20655702 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine |
| SMILES | CN1CCCc2ccc(C(C)(C)C)nc21 |
| InChI | InChI=1S/C13H20N2/c1-13(2,3)11-8-7-10-6-5-9-15(4)12(10)14-11/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | UKIFTMCLSKSCHP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine?
The IUPAC name of 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine (CID 20655702) is 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine.
What is the SMILES notation for 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine?
The canonical SMILES for 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine is CN1CCCc2ccc(C(C)(C)C)nc21.
What is the InChIKey of 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine?
The InChIKey is UKIFTMCLSKSCHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-13(2,3)11-8-7-10-6-5-9-15(4)12(10)14-11/h7-8H,5-6,9H2,1-4H3.
What are the key properties of 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine?
7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine has a molecular weight of 204.32 g/mol, XLogP of 2.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-1-methyl-3,4-dihydro-2H-1,8-naphthyridine is sourced from PubChem (CID 20655702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).