About 2-nitroethanesulfinate
2-nitroethanesulfinate (PubChem CID 20655713) has the molecular formula C2H4NO4S-
and a molecular weight of 138.12 g/mol. Its IUPAC name is 2-nitroethanesulfinate.
Molecular Properties
| Compound Name | 2-nitroethanesulfinate |
| PubChem CID | 20655713 |
| Molecular Formula | C2H4NO4S- |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 137.99 |
| IUPAC Name | 2-nitroethanesulfinate |
| SMILES | O=[N+]([O-])CCS(=O)[O-] |
| InChI | InChI=1S/C2H5NO4S/c4-3(5)1-2-8(6)7/h1-2H2,(H,6,7)/p-1 |
| InChIKey | GBNCLYFSZAPDJX-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroethanesulfinate?
The IUPAC name of 2-nitroethanesulfinate (CID 20655713) is 2-nitroethanesulfinate.
What is the SMILES notation for 2-nitroethanesulfinate?
The canonical SMILES for 2-nitroethanesulfinate is O=[N+]([O-])CCS(=O)[O-].
What is the InChIKey of 2-nitroethanesulfinate?
The InChIKey is GBNCLYFSZAPDJX-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NO4S/c4-3(5)1-2-8(6)7/h1-2H2,(H,6,7)/p-1.
What are the key properties of 2-nitroethanesulfinate?
2-nitroethanesulfinate has a molecular weight of 138.12 g/mol, XLogP of -0.86, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroethanesulfinate is sourced from PubChem (CID 20655713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).