C21H36O5 — CID 20655967
(E)-7-[3,5-dihydroxy-2-[(E)-4-hydroxynon-2-en-2-yl]cyclopentyl]hept-5-enoic acid (PubChem CID 20655967) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is (E)-7-[3,5-dihydroxy-2-[(E)-4-hydroxynon-2-en-2-yl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[3,5-dihydroxy-2-[(E)-4-hydroxynon-2-en-2-yl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 20655967 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (E)-7-[3,5-dihydroxy-2-[(E)-4-hydroxynon-2-en-2-yl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(O)/C=C(\C)C1C(O)CC(O)C1C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C21H36O5/c1-3-4-7-10-16(22)13-15(2)21-17(18(23)14-19(21)24)11-8-5-6-9-12-20(25)26/h5,8,13,16-19,21-24H,3-4,6-7,9-12,14H2,1-2H3,(H,25,26)/b8-5+,15-13+ |
| InChIKey | WCNBTKGVPGFCJS-OYAMYSJUSA-N |
| XLogP | 3.43 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|