C16H30N2O4 — CID 20656294
N-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 20656294) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | N-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 20656294 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | N-(1-formyl-2,2,6,6-tetramethylpiperidin-4-yl)-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(CO)C(O)C(=O)NC1CC(C)(C)N(C=O)C(C)(C)C1 |
| InChI | InChI=1S/C16H30N2O4/c1-14(2,9-19)12(21)13(22)17-11-7-15(3,4)18(10-20)16(5,6)8-11/h10-12,19,21H,7-9H2,1-6H3,(H,17,22) |
| InChIKey | JCFRXUQPHABOQE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|