C32H34N6O6 — CID 20656568
ethyl 4-[[4-(4-ethoxycarbonylanilino)-6-[4-(3-ethoxy-3-oxopropyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 20656568) has the molecular formula C32H34N6O6 and a molecular weight of 598.66 g/mol. Its IUPAC name is ethyl 4-[[4-(4-ethoxycarbonylanilino)-6-[4-(3-ethoxy-3-oxopropyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(4-ethoxycarbonylanilino)-6-[4-(3-ethoxy-3-oxopropyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 20656568 |
| Molecular Formula | C32H34N6O6 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | ethyl 4-[[4-(4-ethoxycarbonylanilino)-6-[4-(3-ethoxy-3-oxopropyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)CCc1ccc(Nc2nc(Nc3ccc(C(=O)OCC)cc3)nc(Nc3ccc(C(=O)OCC)cc3)n2)cc1 |
| InChI | InChI=1S/C32H34N6O6/c1-4-42-27(39)20-9-21-7-14-24(15-8-21)33-30-36-31(34-25-16-10-22(11-17-25)28(40)43-5-2)38-32(37-30)35-26-18-12-23(13-19-26)29(41)44-6-3/h7-8,10-19H,4-6,9,20H2,1-3H3,(H3,33,34,35,36,37,38) |
| InChIKey | JWHWWTAZSHGUKC-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|