C30H32F10O3 — CID 20656624
2-[2-[4-[3,5-difluoro-4-[3-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]phenyl]cyclohexyl]ethyl]-5-propyl-1,3-dioxane (PubChem CID 20656624) has the molecular formula C30H32F10O3 and a molecular weight of 630.56 g/mol. Its IUPAC name is 2-[2-[4-[3,5-difluoro-4-[3-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]phenyl]cyclohexyl]ethyl]-5-propyl-1,3-dioxane.
| Compound Name | 2-[2-[4-[3,5-difluoro-4-[3-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]phenyl]cyclohexyl]ethyl]-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 20656624 |
| Molecular Formula | C30H32F10O3 |
| Molecular Weight | 630.56 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | 2-[2-[4-[3,5-difluoro-4-[3-fluoro-4-(1,1,2,2,3,3,3-heptafluoropropoxy)phenyl]phenyl]cyclohexyl]ethyl]-5-propyl-1,3-dioxane |
| SMILES | CCCC1COC(CCC2CCC(c3cc(F)c(-c4ccc(OC(F)(F)C(F)(F)C(F)(F)F)c(F)c4)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C30H32F10O3/c1-2-3-18-15-41-26(42-16-18)11-6-17-4-7-19(8-5-17)21-13-23(32)27(24(33)14-21)20-9-10-25(22(31)12-20)43-30(39,40)28(34,35)29(36,37)38/h9-10,12-14,17-19,26H,2-8,11,15-16H2,1H3 |
| InChIKey | DPZKDMXGNPWPCT-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.56 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|