C37H25N3O8 — CID 20657071
2-(2,5-dioxo-3-phenylpyrrol-1-yl)ethyl 3-methyl-5-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]benzoate (PubChem CID 20657071) has the molecular formula C37H25N3O8 and a molecular weight of 639.62 g/mol. Its IUPAC name is 2-(2,5-dioxo-3-phenylpyrrol-1-yl)ethyl 3-methyl-5-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]benzoate.
| Compound Name | 2-(2,5-dioxo-3-phenylpyrrol-1-yl)ethyl 3-methyl-5-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 20657071 |
| Molecular Formula | C37H25N3O8 |
| Molecular Weight | 639.62 g/mol |
| Exact Mass | 639.16 |
| IUPAC Name | 2-(2,5-dioxo-3-phenylpyrrol-1-yl)ethyl 3-methyl-5-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]benzoate |
| SMILES | Cc1cc(C(=O)OCCN2C(=O)C=C(c3ccccc3)C2=O)cc(N2C(=O)c3ccc(-c4ccc5c(c4)C(=O)N(C)C5=O)cc3C2=O)c1 |
| InChI | InChI=1S/C37H25N3O8/c1-20-14-24(37(47)48-13-12-39-31(41)19-28(34(39)44)21-6-4-3-5-7-21)16-25(15-20)40-35(45)27-11-9-23(18-30(27)36(40)46)22-8-10-26-29(17-22)33(43)38(2)32(26)42/h3-11,14-19H,12-13H2,1-2H3 |
| InChIKey | OPFYATRPSJWLOW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 138.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|