C41H33N3O8 — CID 20657090
6-(2,5-dioxo-3-phenylpyrrol-1-yl)hexyl 3-methyl-5-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]benzoate (PubChem CID 20657090) has the molecular formula C41H33N3O8 and a molecular weight of 695.73 g/mol. Its IUPAC name is 6-(2,5-dioxo-3-phenylpyrrol-1-yl)hexyl 3-methyl-5-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]benzoate.
| Compound Name | 6-(2,5-dioxo-3-phenylpyrrol-1-yl)hexyl 3-methyl-5-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]benzoate |
|---|---|
| PubChem CID | 20657090 |
| Molecular Formula | C41H33N3O8 |
| Molecular Weight | 695.73 g/mol |
| Exact Mass | 695.23 |
| IUPAC Name | 6-(2,5-dioxo-3-phenylpyrrol-1-yl)hexyl 3-methyl-5-[5-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-2-yl]benzoate |
| SMILES | Cc1cc(C(=O)OCCCCCCN2C(=O)C=C(c3ccccc3)C2=O)cc(N2C(=O)c3ccc(-c4ccc5c(c4)C(=O)N(C)C5=O)cc3C2=O)c1 |
| InChI | InChI=1S/C41H33N3O8/c1-24-18-28(41(51)52-17-9-4-3-8-16-43-35(45)23-32(38(43)48)25-10-6-5-7-11-25)20-29(19-24)44-39(49)31-15-13-27(22-34(31)40(44)50)26-12-14-30-33(21-26)37(47)42(2)36(30)46/h5-7,10-15,18-23H,3-4,8-9,16-17H2,1-2H3 |
| InChIKey | ZBRWOXVYHHQBJT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 138.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.73 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|