C12H34O3Si4 — CID 20657091
ethyl-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane (PubChem CID 20657091) has the molecular formula C12H34O3Si4 and a molecular weight of 338.75 g/mol. Its IUPAC name is ethyl-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | ethyl-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 20657091 |
| Molecular Formula | C12H34O3Si4 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | ethyl-[[[ethyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
| SMILES | CC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CC |
| InChI | InChI=1S/C12H34O3Si4/c1-11-16(3,4)13-18(7,8)15-19(9,10)14-17(5,6)12-2/h11-12H2,1-10H3 |
| InChIKey | NEKOMERILRCUHZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|