C9H15ClO4 — CID 20657640
3-(chloromethyl)-9-methyl-2,4,8,10-tetraoxaspiro[5.5]undecane (PubChem CID 20657640) has the molecular formula C9H15ClO4 and a molecular weight of 222.67 g/mol. Its IUPAC name is 3-(chloromethyl)-9-methyl-2,4,8,10-tetraoxaspiro[5.5]undecane.
| Compound Name | 3-(chloromethyl)-9-methyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 20657640 |
| Molecular Formula | C9H15ClO4 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-(chloromethyl)-9-methyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
| SMILES | CC1OCC2(CO1)COC(CCl)OC2 |
| InChI | InChI=1S/C9H15ClO4/c1-7-11-3-9(4-12-7)5-13-8(2-10)14-6-9/h7-8H,2-6H2,1H3 |
| InChIKey | NQIBOBRSYGRYQL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|