C8H8N2W — CID 20657835
carbanide;2H-imidazo[1,2-a]pyridin-2-ide;tungsten(2+) (PubChem CID 20657835) has the molecular formula C8H8N2W and a molecular weight of 316.01 g/mol. Its IUPAC name is carbanide;2H-imidazo[1,2-a]pyridin-2-ide;tungsten(2+).
| Compound Name | carbanide;2H-imidazo[1,2-a]pyridin-2-ide;tungsten(2+) |
|---|---|
| PubChem CID | 20657835 |
| Molecular Formula | C8H8N2W |
| Molecular Weight | 316.01 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | carbanide;2H-imidazo[1,2-a]pyridin-2-ide;tungsten(2+) |
| SMILES | [CH3-].[W+2].[c-]1cn2ccccc2n1 |
| InChI | InChI=1S/C7H5N2.CH3.W/c1-2-5-9-6-4-8-7(9)3-1;;/h1-3,5-6H;1H3;/q2*-1;+2 |
| InChIKey | GUCOQQYQGZSBMM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.01 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|