C24H30N2 — CID 20657872
6,12,13,15-tetramethyl-2-(1-methylpiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene (PubChem CID 20657872) has the molecular formula C24H30N2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 6,12,13,15-tetramethyl-2-(1-methylpiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene.
| Compound Name | 6,12,13,15-tetramethyl-2-(1-methylpiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene |
|---|---|
| PubChem CID | 20657872 |
| Molecular Formula | C24H30N2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 6,12,13,15-tetramethyl-2-(1-methylpiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene |
| SMILES | Cc1cnc2c(c1)CCc1c(C)c(C)cc(C)c1C2=C1CCN(C)CC1 |
| InChI | InChI=1S/C24H30N2/c1-15-12-20-6-7-21-18(4)16(2)13-17(3)22(21)23(24(20)25-14-15)19-8-10-26(5)11-9-19/h12-14H,6-11H2,1-5H3 |
| InChIKey | QAKLZEZDVOFWMN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |