About 1-tert-butylsulfonyl-4,4-dimethylpentane
1-tert-butylsulfonyl-4,4-dimethylpentane (PubChem CID 20657893) has the molecular formula C11H24O2S
and a molecular weight of 220.38 g/mol. Its IUPAC name is 1-tert-butylsulfonyl-4,4-dimethylpentane.
Molecular Properties
| Compound Name | 1-tert-butylsulfonyl-4,4-dimethylpentane |
| PubChem CID | 20657893 |
| Molecular Formula | C11H24O2S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-tert-butylsulfonyl-4,4-dimethylpentane |
| SMILES | CC(C)(C)CCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C11H24O2S/c1-10(2,3)8-7-9-14(12,13)11(4,5)6/h7-9H2,1-6H3 |
| InChIKey | RYMKDFCJKOLPAW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butylsulfonyl-4,4-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfonyl-4,4-dimethylpentane?
The IUPAC name of 1-tert-butylsulfonyl-4,4-dimethylpentane (CID 20657893) is 1-tert-butylsulfonyl-4,4-dimethylpentane.
What is the SMILES notation for 1-tert-butylsulfonyl-4,4-dimethylpentane?
The canonical SMILES for 1-tert-butylsulfonyl-4,4-dimethylpentane is CC(C)(C)CCCS(=O)(=O)C(C)(C)C.
What is the InChIKey of 1-tert-butylsulfonyl-4,4-dimethylpentane?
The InChIKey is RYMKDFCJKOLPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O2S/c1-10(2,3)8-7-9-14(12,13)11(4,5)6/h7-9H2,1-6H3.
What are the key properties of 1-tert-butylsulfonyl-4,4-dimethylpentane?
1-tert-butylsulfonyl-4,4-dimethylpentane has a molecular weight of 220.38 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfonyl-4,4-dimethylpentane is sourced from PubChem (CID 20657893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).