C35H53N5O5 — CID 20658029
(2S)-5-cyclohexyl-2-[[(2-imidazol-1-ylacetyl)-(2-phenylethyl)amino]-(4-methylpentanoyl)amino]-N-[(2R)-oxan-2-yl]oxypentanamide (PubChem CID 20658029) has the molecular formula C35H53N5O5 and a molecular weight of 623.84 g/mol. Its IUPAC name is (2S)-5-cyclohexyl-2-[[(2-imidazol-1-ylacetyl)-(2-phenylethyl)amino]-(4-methylpentanoyl)amino]-N-[(2R)-oxan-2-yl]oxypentanamide.
| Compound Name | (2S)-5-cyclohexyl-2-[[(2-imidazol-1-ylacetyl)-(2-phenylethyl)amino]-(4-methylpentanoyl)amino]-N-[(2R)-oxan-2-yl]oxypentanamide |
|---|---|
| PubChem CID | 20658029 |
| Molecular Formula | C35H53N5O5 |
| Molecular Weight | 623.84 g/mol |
| Exact Mass | 623.40 |
| IUPAC Name | (2S)-5-cyclohexyl-2-[[(2-imidazol-1-ylacetyl)-(2-phenylethyl)amino]-(4-methylpentanoyl)amino]-N-[(2R)-oxan-2-yl]oxypentanamide |
| SMILES | CC(C)CCC(=O)N([C@@H](CCCC1CCCCC1)C(=O)NO[C@@H]1CCCCO1)N(CCc1ccccc1)C(=O)Cn1ccnc1 |
| InChI | InChI=1S/C35H53N5O5/c1-28(2)19-20-32(41)40(39(23-21-30-14-7-4-8-15-30)33(42)26-38-24-22-36-27-38)31(17-11-16-29-12-5-3-6-13-29)35(43)37-45-34-18-9-10-25-44-34/h4,7-8,14-15,22,24,27-29,31,34H,3,5-6,9-13,16-21,23,25-26H2,1-2H3,(H,37,43)/t31-,34+/m0/s1 |
| InChIKey | KTJVLOCMCYZJIP-AFPLUKJUSA-N |
| XLogP | 5.83 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.84 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|