C27H34O2 — CID 20658762
6-[(Z)-[6-(hydroperoxymethyl)-3,4-dihydro-2H-naphthalen-1-ylidene]methyl]-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene (PubChem CID 20658762) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 6-[(Z)-[6-(hydroperoxymethyl)-3,4-dihydro-2H-naphthalen-1-ylidene]methyl]-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene.
| Compound Name | 6-[(Z)-[6-(hydroperoxymethyl)-3,4-dihydro-2H-naphthalen-1-ylidene]methyl]-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 20658762 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 6-[(Z)-[6-(hydroperoxymethyl)-3,4-dihydro-2H-naphthalen-1-ylidene]methyl]-1,1,4,4,7-pentamethyl-2,3-dihydronaphthalene |
| SMILES | Cc1cc2c(cc1/C=C1/CCCc3cc(COO)ccc31)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H34O2/c1-18-13-24-25(27(4,5)12-11-26(24,2)3)16-22(18)15-21-8-6-7-20-14-19(17-29-28)9-10-23(20)21/h9-10,13-16,28H,6-8,11-12,17H2,1-5H3/b21-15- |
| InChIKey | DUAQLXSCFVUBLE-QNGOZBTKSA-N |
| XLogP | 7.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|