C33H68 — CID 20658770
2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12-icosamethyltridecane (PubChem CID 20658770) has the molecular formula C33H68 and a molecular weight of 464.91 g/mol. Its IUPAC name is 2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12-icosamethyltridecane.
| Compound Name | 2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12-icosamethyltridecane |
|---|---|
| PubChem CID | 20658770 |
| Molecular Formula | C33H68 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.53 |
| IUPAC Name | 2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12-icosamethyltridecane |
| SMILES | CC(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C33H68/c1-23(2)25(5,6)27(9,10)29(13,14)31(17,18)33(21,22)32(19,20)30(15,16)28(11,12)26(7,8)24(3)4/h23-24H,1-22H3 |
| InChIKey | RNBFOALFVNUKNK-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |