C10H4F9IO — CID 20658832
1-iodo-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)benzene (PubChem CID 20658832) has the molecular formula C10H4F9IO and a molecular weight of 438.03 g/mol. Its IUPAC name is 1-iodo-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)benzene.
| Compound Name | 1-iodo-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)benzene |
|---|---|
| PubChem CID | 20658832 |
| Molecular Formula | C10H4F9IO |
| Molecular Weight | 438.03 g/mol |
| Exact Mass | 437.92 |
| IUPAC Name | 1-iodo-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)Oc1ccccc1I |
| InChI | InChI=1S/C10H4F9IO/c11-7(12,9(15,16)17)8(13,14)10(18,19)21-6-4-2-1-3-5(6)20/h1-4H |
| InChIKey | HMIDVFVMRIVENZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.03 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|