About 3-amino-5,6-dimethyloctan-4-ol
3-amino-5,6-dimethyloctan-4-ol (PubChem CID 20658862) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is 3-amino-5,6-dimethyloctan-4-ol.
Molecular Properties
| Compound Name | 3-amino-5,6-dimethyloctan-4-ol |
| PubChem CID | 20658862 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | 3-amino-5,6-dimethyloctan-4-ol |
| SMILES | CCC(C)C(C)C(O)C(N)CC |
| InChI | InChI=1S/C10H23NO/c1-5-7(3)8(4)10(12)9(11)6-2/h7-10,12H,5-6,11H2,1-4H3 |
| InChIKey | URPTZWWOHAVAER-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-5,6-dimethyloctan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5,6-dimethyloctan-4-ol?
The IUPAC name of 3-amino-5,6-dimethyloctan-4-ol (CID 20658862) is 3-amino-5,6-dimethyloctan-4-ol.
What is the SMILES notation for 3-amino-5,6-dimethyloctan-4-ol?
The canonical SMILES for 3-amino-5,6-dimethyloctan-4-ol is CCC(C)C(C)C(O)C(N)CC.
What is the InChIKey of 3-amino-5,6-dimethyloctan-4-ol?
The InChIKey is URPTZWWOHAVAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO/c1-5-7(3)8(4)10(12)9(11)6-2/h7-10,12H,5-6,11H2,1-4H3.
What are the key properties of 3-amino-5,6-dimethyloctan-4-ol?
3-amino-5,6-dimethyloctan-4-ol has a molecular weight of 173.30 g/mol, XLogP of 1.77, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5,6-dimethyloctan-4-ol is sourced from PubChem (CID 20658862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).