C18H30 — CID 20658909
4-[1-(1,2-dimethyl-2-prop-1-en-2-ylcyclopropyl)ethyl]-1,5,5-trimethylcyclopentene (PubChem CID 20658909) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 4-[1-(1,2-dimethyl-2-prop-1-en-2-ylcyclopropyl)ethyl]-1,5,5-trimethylcyclopentene.
| Compound Name | 4-[1-(1,2-dimethyl-2-prop-1-en-2-ylcyclopropyl)ethyl]-1,5,5-trimethylcyclopentene |
|---|---|
| PubChem CID | 20658909 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 4-[1-(1,2-dimethyl-2-prop-1-en-2-ylcyclopropyl)ethyl]-1,5,5-trimethylcyclopentene |
| SMILES | C=C(C)C1(C)CC1(C)C(C)C1CC=C(C)C1(C)C |
| InChI | InChI=1S/C18H30/c1-12(2)17(7)11-18(17,8)14(4)15-10-9-13(3)16(15,5)6/h9,14-15H,1,10-11H2,2-8H3 |
| InChIKey | ATACDKNDYMCMNK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|