C11H13ClN6O3S — CID 20658966
2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-(ethylamino)benzenesulfonic acid (PubChem CID 20658966) has the molecular formula C11H13ClN6O3S and a molecular weight of 344.78 g/mol. Its IUPAC name is 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-(ethylamino)benzenesulfonic acid.
| Compound Name | 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-(ethylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 20658966 |
| Molecular Formula | C11H13ClN6O3S |
| Molecular Weight | 344.78 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-4-(ethylamino)benzenesulfonic acid |
| SMILES | CCNc1ccc(S(=O)(=O)O)c(Nc2nc(N)nc(Cl)n2)c1 |
| InChI | InChI=1S/C11H13ClN6O3S/c1-2-14-6-3-4-8(22(19,20)21)7(5-6)15-11-17-9(12)16-10(13)18-11/h3-5,14H,2H2,1H3,(H,19,20,21)(H3,13,15,16,17,18) |
| InChIKey | QUFNNARIOIZOKF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.78 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|