About 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one
6-hydroxy-1,3,4,5-tetramethylpyridin-2-one (PubChem CID 20658982) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one.
Molecular Properties
| Compound Name | 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one |
| PubChem CID | 20658982 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one |
| SMILES | Cc1c(C)c(O)n(C)c(=O)c1C |
| InChI | InChI=1S/C9H13NO2/c1-5-6(2)8(11)10(4)9(12)7(5)3/h11H,1-4H3 |
| InChIKey | WKGFSLHPKXDWEH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one?
The IUPAC name of 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one (CID 20658982) is 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one.
What is the SMILES notation for 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one?
The canonical SMILES for 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one is Cc1c(C)c(O)n(C)c(=O)c1C.
What is the InChIKey of 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one?
The InChIKey is WKGFSLHPKXDWEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-5-6(2)8(11)10(4)9(12)7(5)3/h11H,1-4H3.
What are the key properties of 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one?
6-hydroxy-1,3,4,5-tetramethylpyridin-2-one has a molecular weight of 167.21 g/mol, XLogP of 1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1,3,4,5-tetramethylpyridin-2-one is sourced from PubChem (CID 20658982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).